C23H36NO5PSSi — CID 177407076
N-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphoryl-2-phenylethyl]-4-methylbenzenesulfinamide (PubChem CID 177407076) has the molecular formula C23H36NO5PSSi and a molecular weight of 497.67 g/mol. Its IUPAC name is N-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphoryl-2-phenylethyl]-4-methylbenzenesulfinamide.
| Compound Name | N-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphoryl-2-phenylethyl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 177407076 |
| Molecular Formula | C23H36NO5PSSi |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphoryl-2-phenylethyl]-4-methylbenzenesulfinamide |
| SMILES | COP(=O)(OC)[C@H](NS(=O)c1ccc(C)cc1)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H36NO5PSSi/c1-18-14-16-20(17-15-18)31(26)24-22(30(25,27-5)28-6)21(19-12-10-9-11-13-19)29-32(7,8)23(2,3)4/h9-17,21-22,24H,1-8H3/t21-,22-,31?/m0/s1 |
| InChIKey | UQFXKLVPHHDXAQ-PCSXXEMLSA-N |
| XLogP | 6.18 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|