C20H27ClNO4PS — CID 11732961
(S)-N-[(1R,2R)-2-chloro-2-diethoxyphosphoryl-1-phenylpropyl]-4-methylbenzenesulfinamide (PubChem CID 11732961) has the molecular formula C20H27ClNO4PS and a molecular weight of 443.93 g/mol. Its IUPAC name is (S)-N-[(1R,2R)-2-chloro-2-diethoxyphosphoryl-1-phenylpropyl]-4-methylbenzenesulfinamide.
| Compound Name | (S)-N-[(1R,2R)-2-chloro-2-diethoxyphosphoryl-1-phenylpropyl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 11732961 |
| Molecular Formula | C20H27ClNO4PS |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | (S)-N-[(1R,2R)-2-chloro-2-diethoxyphosphoryl-1-phenylpropyl]-4-methylbenzenesulfinamide |
| SMILES | CCOP(=O)(OCC)[C@](C)(Cl)[C@H](N[S@@](=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H27ClNO4PS/c1-5-25-27(23,26-6-2)20(4,21)19(17-10-8-7-9-11-17)22-28(24)18-14-12-16(3)13-15-18/h7-15,19,22H,5-6H2,1-4H3/t19-,20+,28+/m1/s1 |
| InChIKey | TWOULYLDXWILBS-HNPLUWAHSA-N |
| XLogP | 5.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|