C24H34NO6PS — CID 11248958
(S)-N-[(1R)-1-diethoxyphosphoryl-4-(2-phenyl-1,3-dioxolan-2-yl)butyl]-4-methylbenzenesulfinamide (PubChem CID 11248958) has the molecular formula C24H34NO6PS and a molecular weight of 495.58 g/mol. Its IUPAC name is (S)-N-[(1R)-1-diethoxyphosphoryl-4-(2-phenyl-1,3-dioxolan-2-yl)butyl]-4-methylbenzenesulfinamide.
| Compound Name | (S)-N-[(1R)-1-diethoxyphosphoryl-4-(2-phenyl-1,3-dioxolan-2-yl)butyl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 11248958 |
| Molecular Formula | C24H34NO6PS |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (S)-N-[(1R)-1-diethoxyphosphoryl-4-(2-phenyl-1,3-dioxolan-2-yl)butyl]-4-methylbenzenesulfinamide |
| SMILES | CCOP(=O)(OCC)[C@H](CCCC1(c2ccccc2)OCCO1)N[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H34NO6PS/c1-4-30-32(26,31-5-2)23(25-33(27)22-15-13-20(3)14-16-22)12-9-17-24(28-18-19-29-24)21-10-7-6-8-11-21/h6-8,10-11,13-16,23,25H,4-5,9,12,17-19H2,1-3H3/t23-,33+/m1/s1 |
| InChIKey | CRRGKCMDOYOETE-NHRFMIRVSA-N |
| XLogP | 5.27 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|