C13H17IO2 — CID 15936562
2-(4-iodobutyl)-2-phenyl-1,3-dioxolane (PubChem CID 15936562) has the molecular formula C13H17IO2 and a molecular weight of 332.18 g/mol. Its IUPAC name is 2-(4-iodobutyl)-2-phenyl-1,3-dioxolane.
| Compound Name | 2-(4-iodobutyl)-2-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 15936562 |
| Molecular Formula | C13H17IO2 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 2-(4-iodobutyl)-2-phenyl-1,3-dioxolane |
| SMILES | ICCCCC1(c2ccccc2)OCCO1 |
| InChI | InChI=1S/C13H17IO2/c14-9-5-4-8-13(15-10-11-16-13)12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-11H2 |
| InChIKey | HBKGIRRKUATFSP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|