C14H19ClO3 — CID 20547832
2-(4-chlorobutyl)-2-(4-methoxyphenyl)-1,3-dioxolane (PubChem CID 20547832) has the molecular formula C14H19ClO3 and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-(4-chlorobutyl)-2-(4-methoxyphenyl)-1,3-dioxolane.
| Compound Name | 2-(4-chlorobutyl)-2-(4-methoxyphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 20547832 |
| Molecular Formula | C14H19ClO3 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-(4-chlorobutyl)-2-(4-methoxyphenyl)-1,3-dioxolane |
| SMILES | COc1ccc(C2(CCCCCl)OCCO2)cc1 |
| InChI | InChI=1S/C14H19ClO3/c1-16-13-6-4-12(5-7-13)14(8-2-3-9-15)17-10-11-18-14/h4-7H,2-3,8-11H2,1H3 |
| InChIKey | HLEMXSKEDMEZFX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|