C14H13F5O4 — CID 20710207
2-(2-phenyl-1,3-dioxolan-2-yl)ethyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 20710207) has the molecular formula C14H13F5O4 and a molecular weight of 340.24 g/mol. Its IUPAC name is 2-(2-phenyl-1,3-dioxolan-2-yl)ethyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 2-(2-phenyl-1,3-dioxolan-2-yl)ethyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 20710207 |
| Molecular Formula | C14H13F5O4 |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-(2-phenyl-1,3-dioxolan-2-yl)ethyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(OCCC1(c2ccccc2)OCCO1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H13F5O4/c15-13(16,14(17,18)19)11(20)21-7-6-12(22-8-9-23-12)10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | DROCKTJJADAOIU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|