C26H37NO3 — CID 144690568
N-[2-(2-phenyl-1,3-dioxolan-2-yl)ethoxy]-2,4,6-tri(propan-2-yl)aniline (PubChem CID 144690568) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is N-[2-(2-phenyl-1,3-dioxolan-2-yl)ethoxy]-2,4,6-tri(propan-2-yl)aniline.
| Compound Name | N-[2-(2-phenyl-1,3-dioxolan-2-yl)ethoxy]-2,4,6-tri(propan-2-yl)aniline |
|---|---|
| PubChem CID | 144690568 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | N-[2-(2-phenyl-1,3-dioxolan-2-yl)ethoxy]-2,4,6-tri(propan-2-yl)aniline |
| SMILES | CC(C)c1cc(C(C)C)c(NOCCC2(c3ccccc3)OCCO2)c(C(C)C)c1 |
| InChI | InChI=1S/C26H37NO3/c1-18(2)21-16-23(19(3)4)25(24(17-21)20(5)6)27-30-13-12-26(28-14-15-29-26)22-10-8-7-9-11-22/h7-11,16-20,27H,12-15H2,1-6H3 |
| InChIKey | XAXSMHZVBGAVFM-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|