C19H23O5P — CID 20710205
2-[2-[ethoxy(phenyl)phosphoryl]oxyethyl]-2-phenyl-1,3-dioxolane (PubChem CID 20710205) has the molecular formula C19H23O5P and a molecular weight of 362.36 g/mol. Its IUPAC name is 2-[2-[ethoxy(phenyl)phosphoryl]oxyethyl]-2-phenyl-1,3-dioxolane.
| Compound Name | 2-[2-[ethoxy(phenyl)phosphoryl]oxyethyl]-2-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 20710205 |
| Molecular Formula | C19H23O5P |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[2-[ethoxy(phenyl)phosphoryl]oxyethyl]-2-phenyl-1,3-dioxolane |
| SMILES | CCOP(=O)(OCCC1(c2ccccc2)OCCO1)c1ccccc1 |
| InChI | InChI=1S/C19H23O5P/c1-2-23-25(20,18-11-7-4-8-12-18)24-14-13-19(21-15-16-22-19)17-9-5-3-6-10-17/h3-12H,2,13-16H2,1H3 |
| InChIKey | AXSGUPFOAMLTMR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|