C23H30N2O3 — CID 67915089
1-[2,6-di(propan-2-yl)phenyl]-1-[(2-phenyl-1,3-dioxolan-2-yl)methyl]urea (PubChem CID 67915089) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-1-[(2-phenyl-1,3-dioxolan-2-yl)methyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-1-[(2-phenyl-1,3-dioxolan-2-yl)methyl]urea |
|---|---|
| PubChem CID | 67915089 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-1-[(2-phenyl-1,3-dioxolan-2-yl)methyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1N(CC1(c2ccccc2)OCCO1)C(N)=O |
| InChI | InChI=1S/C23H30N2O3/c1-16(2)19-11-8-12-20(17(3)4)21(19)25(22(24)26)15-23(27-13-14-28-23)18-9-6-5-7-10-18/h5-12,16-17H,13-15H2,1-4H3,(H2,24,26) |
| InChIKey | SQLITYMSTFHRHI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |