C22H29NO4 — CID 91447881
ethane;(2S)-N-methoxy-2-methyl-3-[2-(4-phenylphenyl)-1,3-dioxolan-2-yl]propanamide (PubChem CID 91447881) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is ethane;(2S)-N-methoxy-2-methyl-3-[2-(4-phenylphenyl)-1,3-dioxolan-2-yl]propanamide.
| Compound Name | ethane;(2S)-N-methoxy-2-methyl-3-[2-(4-phenylphenyl)-1,3-dioxolan-2-yl]propanamide |
|---|---|
| PubChem CID | 91447881 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | ethane;(2S)-N-methoxy-2-methyl-3-[2-(4-phenylphenyl)-1,3-dioxolan-2-yl]propanamide |
| SMILES | CC.CONC(=O)[C@@H](C)CC1(c2ccc(-c3ccccc3)cc2)OCCO1 |
| InChI | InChI=1S/C20H23NO4.C2H6/c1-15(19(22)21-23-2)14-20(24-12-13-25-20)18-10-8-17(9-11-18)16-6-4-3-5-7-16;1-2/h3-11,15H,12-14H2,1-2H3,(H,21,22);1-2H3/t15-;/m0./s1 |
| InChIKey | GKTOFLBHSMJDGQ-RSAXXLAASA-N |
| XLogP | 4.28 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|