C23H25NO2 — CID 144913601
1,1'-biphenyl;N-methoxy-3-phenylbutanamide (PubChem CID 144913601) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 1,1'-biphenyl;N-methoxy-3-phenylbutanamide.
| Compound Name | 1,1'-biphenyl;N-methoxy-3-phenylbutanamide |
|---|---|
| PubChem CID | 144913601 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 1,1'-biphenyl;N-methoxy-3-phenylbutanamide |
| SMILES | CONC(=O)CC(C)c1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C11H15NO2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-9(8-11(13)12-14-2)10-6-4-3-5-7-10/h1-10H;3-7,9H,8H2,1-2H3,(H,12,13) |
| InChIKey | ZSODWWCLEHBITI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|