C29H39N3O — CID 54057644
1-[2,6-di(propan-2-yl)phenyl]-1-[5-methyl-2-(1-methylindol-3-yl)hex-4-enyl]urea (PubChem CID 54057644) has the molecular formula C29H39N3O and a molecular weight of 445.65 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-1-[5-methyl-2-(1-methylindol-3-yl)hex-4-enyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-1-[5-methyl-2-(1-methylindol-3-yl)hex-4-enyl]urea |
|---|---|
| PubChem CID | 54057644 |
| Molecular Formula | C29H39N3O |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-1-[5-methyl-2-(1-methylindol-3-yl)hex-4-enyl]urea |
| SMILES | CC(C)=CCC(CN(C(N)=O)c1c(C(C)C)cccc1C(C)C)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C29H39N3O/c1-19(2)15-16-22(26-18-31(7)27-14-9-8-11-25(26)27)17-32(29(30)33)28-23(20(3)4)12-10-13-24(28)21(5)6/h8-15,18,20-22H,16-17H2,1-7H3,(H2,30,33) |
| InChIKey | LXJUMNHVJCKRQZ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|