C25H39N4O2PS — CID 11092176
(S)-N-[(S)-[(2S)-1-benzylaziridin-2-yl]-[bis(diethylamino)phosphoryl]methyl]-4-methylbenzenesulfinamide (PubChem CID 11092176) has the molecular formula C25H39N4O2PS and a molecular weight of 490.65 g/mol. Its IUPAC name is (S)-N-[(S)-[(2S)-1-benzylaziridin-2-yl]-[bis(diethylamino)phosphoryl]methyl]-4-methylbenzenesulfinamide.
| Compound Name | (S)-N-[(S)-[(2S)-1-benzylaziridin-2-yl]-[bis(diethylamino)phosphoryl]methyl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 11092176 |
| Molecular Formula | C25H39N4O2PS |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | (S)-N-[(S)-[(2S)-1-benzylaziridin-2-yl]-[bis(diethylamino)phosphoryl]methyl]-4-methylbenzenesulfinamide |
| SMILES | CCN(CC)P(=O)([C@H](N[S@@](=O)c1ccc(C)cc1)[C@@H]1CN1Cc1ccccc1)N(CC)CC |
| InChI | InChI=1S/C25H39N4O2PS/c1-6-28(7-2)32(30,29(8-3)9-4)25(26-33(31)23-17-15-21(5)16-18-23)24-20-27(24)19-22-13-11-10-12-14-22/h10-18,24-26H,6-9,19-20H2,1-5H3/t24-,25-,27?,33-/m0/s1 |
| InChIKey | WXYXJNKKVRPZKS-SQDDFNQYSA-N |
| XLogP | 4.69 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|