C17H17NO2S2 — CID 132608733
(4S)-4-benzyl-3-(4-methylphenyl)sulfinyl-1,3-oxazolidine-2-thione (PubChem CID 132608733) has the molecular formula C17H17NO2S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(4-methylphenyl)sulfinyl-1,3-oxazolidine-2-thione.
| Compound Name | (4S)-4-benzyl-3-(4-methylphenyl)sulfinyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 132608733 |
| Molecular Formula | C17H17NO2S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (4S)-4-benzyl-3-(4-methylphenyl)sulfinyl-1,3-oxazolidine-2-thione |
| SMILES | Cc1ccc(S(=O)N2C(=S)OC[C@@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H17NO2S2/c1-13-7-9-16(10-8-13)22(19)18-15(12-20-17(18)21)11-14-5-3-2-4-6-14/h2-10,15H,11-12H2,1H3/t15-,22?/m0/s1 |
| InChIKey | ZQRJBQXQTHSBAV-UEDXYCIISA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|