About (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate
(2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 166698881) has the molecular formula C20H19NO5
and a molecular weight of 353.37 g/mol. Its IUPAC name is (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate.
Molecular Properties
| Compound Name | (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate |
| PubChem CID | 166698881 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | Cc1ccc(C(=O)OC(=O)N2C(=O)OC[C@H]2Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H19NO5/c1-13-8-9-17(14(2)10-13)18(22)26-20(24)21-16(12-25-19(21)23)11-15-6-4-3-5-7-15/h3-10,16H,11-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | RWSJQMJCCIFFDV-MRXNPFEDSA-N |
| XLogP | 3.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate?
The IUPAC name of (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate (CID 166698881) is (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate.
What is the SMILES notation for (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate?
The canonical SMILES for (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate is Cc1ccc(C(=O)OC(=O)N2C(=O)OC[C@H]2Cc2ccccc2)c(C)c1.
What is the InChIKey of (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate?
The InChIKey is RWSJQMJCCIFFDV-MRXNPFEDSA-N. The full InChI is InChI=1S/C20H19NO5/c1-13-8-9-17(14(2)10-13)18(22)26-20(24)21-16(12-25-19(21)23)11-15-6-4-3-5-7-15/h3-10,16H,11-12H2,1-2H3/t16-/m1/s1.
What are the key properties of (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate?
(2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate has a molecular weight of 353.37 g/mol, XLogP of 3.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethylbenzoyl) (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carboxylate is sourced from PubChem (CID 166698881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).