C15H16INO2S — CID 24862496
(Z)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-5-iodopent-4-en-1-one (PubChem CID 24862496) has the molecular formula C15H16INO2S and a molecular weight of 401.27 g/mol. Its IUPAC name is (Z)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-5-iodopent-4-en-1-one.
| Compound Name | (Z)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-5-iodopent-4-en-1-one |
|---|---|
| PubChem CID | 24862496 |
| Molecular Formula | C15H16INO2S |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | (Z)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-5-iodopent-4-en-1-one |
| SMILES | O=C(CC/C=C\I)N1C(=S)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C15H16INO2S/c16-9-5-4-8-14(18)17-13(11-19-15(17)20)10-12-6-2-1-3-7-12/h1-3,5-7,9,13H,4,8,10-11H2/b9-5-/t13-/m0/s1 |
| InChIKey | LVUNNSSHJZKCKB-QGOGUYACSA-N |
| XLogP | 3.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|