C17H22NO4P — CID 23397650
4-benzyl-3-[(E)-5-methyl-6-phosphanyloxyhex-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 23397650) has the molecular formula C17H22NO4P and a molecular weight of 335.34 g/mol. Its IUPAC name is 4-benzyl-3-[(E)-5-methyl-6-phosphanyloxyhex-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-[(E)-5-methyl-6-phosphanyloxyhex-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23397650 |
| Molecular Formula | C17H22NO4P |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-benzyl-3-[(E)-5-methyl-6-phosphanyloxyhex-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C/C(=C\CCC(=O)N1C(=O)OCC1Cc1ccccc1)COP |
| InChI | InChI=1S/C17H22NO4P/c1-13(11-22-23)6-5-9-16(19)18-15(12-21-17(18)20)10-14-7-3-2-4-8-14/h2-4,6-8,15H,5,9-12,23H2,1H3/b13-6+ |
| InChIKey | NJCLBJJJJVRMSW-AWNIVKPZSA-N |
| XLogP | 3.11 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|