C28H34N2 — CID 10810913
(1S)-N,N-dibenzyl-1-[(2S)-1-benzylaziridin-2-yl]-3-methylbutan-1-amine (PubChem CID 10810913) has the molecular formula C28H34N2 and a molecular weight of 398.59 g/mol. Its IUPAC name is (1S)-N,N-dibenzyl-1-[(2S)-1-benzylaziridin-2-yl]-3-methylbutan-1-amine.
| Compound Name | (1S)-N,N-dibenzyl-1-[(2S)-1-benzylaziridin-2-yl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 10810913 |
| Molecular Formula | C28H34N2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (1S)-N,N-dibenzyl-1-[(2S)-1-benzylaziridin-2-yl]-3-methylbutan-1-amine |
| SMILES | CC(C)C[C@@H]([C@@H]1CN1Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H34N2/c1-23(2)18-27(28-22-30(28)21-26-16-10-5-11-17-26)29(19-24-12-6-3-7-13-24)20-25-14-8-4-9-15-25/h3-17,23,27-28H,18-22H2,1-2H3/t27-,28-,30?/m0/s1 |
| InChIKey | GBUMFLMBRXKCCD-SRBHEWTHSA-N |
| XLogP | 5.99 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|