C14H19F2N — CID 158286419
(2R,5R)-1-benzyl-2-(difluoromethyl)-5-methylpiperidine (PubChem CID 158286419) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is (2R,5R)-1-benzyl-2-(difluoromethyl)-5-methylpiperidine.
| Compound Name | (2R,5R)-1-benzyl-2-(difluoromethyl)-5-methylpiperidine |
|---|---|
| PubChem CID | 158286419 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (2R,5R)-1-benzyl-2-(difluoromethyl)-5-methylpiperidine |
| SMILES | C[C@@H]1CC[C@H](C(F)F)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H19F2N/c1-11-7-8-13(14(15)16)17(9-11)10-12-5-3-2-4-6-12/h2-6,11,13-14H,7-10H2,1H3/t11-,13-/m1/s1 |
| InChIKey | QLWRRKFAVVMHOF-DGCLKSJQSA-N |
| XLogP | 3.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |