C24H38NO5PSSi — CID 23420563
N-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphoryl-3-phenylpropyl]-4-methylbenzenesulfinamide (PubChem CID 23420563) has the molecular formula C24H38NO5PSSi and a molecular weight of 511.70 g/mol. Its IUPAC name is N-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphoryl-3-phenylpropyl]-4-methylbenzenesulfinamide.
| Compound Name | N-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphoryl-3-phenylpropyl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 23420563 |
| Molecular Formula | C24H38NO5PSSi |
| Molecular Weight | 511.70 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | N-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphoryl-3-phenylpropyl]-4-methylbenzenesulfinamide |
| SMILES | COP(=O)(OC)[C@@H](NS(=O)c1ccc(C)cc1)[C@H](Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H38NO5PSSi/c1-19-14-16-21(17-15-19)32(27)25-23(31(26,28-5)29-6)22(18-20-12-10-9-11-13-20)30-33(7,8)24(2,3)4/h9-17,22-23,25H,18H2,1-8H3/t22-,23+,32?/m0/s1 |
| InChIKey | GITAHEXRJSBTRY-ODFFKVLCSA-N |
| XLogP | 6.05 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.70 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|