C23H29N3O2SSi — CID 102010983
N-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-2,2-dicyano-1-phenylethyl]-4-methylbenzenesulfinamide (PubChem CID 102010983) has the molecular formula C23H29N3O2SSi and a molecular weight of 439.66 g/mol. Its IUPAC name is N-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-2,2-dicyano-1-phenylethyl]-4-methylbenzenesulfinamide.
| Compound Name | N-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-2,2-dicyano-1-phenylethyl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 102010983 |
| Molecular Formula | C23H29N3O2SSi |
| Molecular Weight | 439.66 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-2,2-dicyano-1-phenylethyl]-4-methylbenzenesulfinamide |
| SMILES | Cc1ccc(S(=O)N[C@@H](c2ccccc2)C(C#N)(C#N)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H29N3O2SSi/c1-18-12-14-20(15-13-18)29(27)26-21(19-10-8-7-9-11-19)23(16-24,17-25)28-30(5,6)22(2,3)4/h7-15,21,26H,1-6H3/t21-,29?/m0/s1 |
| InChIKey | GEYZFYDEVQSUDR-TYKNXJODSA-N |
| XLogP | 5.16 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|