C13H23NO6P2S — CID 15230159
[(6-phenylsulfanylhexylamino)-phosphonomethyl]phosphonic acid (PubChem CID 15230159) has the molecular formula C13H23NO6P2S and a molecular weight of 383.34 g/mol. Its IUPAC name is [(6-phenylsulfanylhexylamino)-phosphonomethyl]phosphonic acid.
| Compound Name | [(6-phenylsulfanylhexylamino)-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 15230159 |
| Molecular Formula | C13H23NO6P2S |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | [(6-phenylsulfanylhexylamino)-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(NCCCCCCSc1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C13H23NO6P2S/c15-21(16,17)13(22(18,19)20)14-10-6-1-2-7-11-23-12-8-4-3-5-9-12/h3-5,8-9,13-14H,1-2,6-7,10-11H2,(H2,15,16,17)(H2,18,19,20) |
| InChIKey | YNPPMECFYJTOGU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|