C7H17N5O6P2S — CID 139621159
[[4-(1-methyltetrazol-5-yl)sulfanylbutylamino]-phosphonomethyl]phosphonic acid (PubChem CID 139621159) has the molecular formula C7H17N5O6P2S and a molecular weight of 361.26 g/mol. Its IUPAC name is [[4-(1-methyltetrazol-5-yl)sulfanylbutylamino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[4-(1-methyltetrazol-5-yl)sulfanylbutylamino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 139621159 |
| Molecular Formula | C7H17N5O6P2S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | [[4-(1-methyltetrazol-5-yl)sulfanylbutylamino]-phosphonomethyl]phosphonic acid |
| SMILES | Cn1nnnc1SCCCCNC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C7H17N5O6P2S/c1-12-6(9-10-11-12)21-5-3-2-4-8-7(19(13,14)15)20(16,17)18/h7-8H,2-5H2,1H3,(H2,13,14,15)(H2,16,17,18) |
| InChIKey | YBMAYRUZJARFIF-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 170.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|