C9H19N5OS — CID 64898439
4-(1-methyltetrazol-5-yl)sulfanyl-3-(propylamino)butan-1-ol (PubChem CID 64898439) has the molecular formula C9H19N5OS and a molecular weight of 245.35 g/mol. Its IUPAC name is 4-(1-methyltetrazol-5-yl)sulfanyl-3-(propylamino)butan-1-ol.
| Compound Name | 4-(1-methyltetrazol-5-yl)sulfanyl-3-(propylamino)butan-1-ol |
|---|---|
| PubChem CID | 64898439 |
| Molecular Formula | C9H19N5OS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 4-(1-methyltetrazol-5-yl)sulfanyl-3-(propylamino)butan-1-ol |
| SMILES | CCCNC(CCO)CSc1nnnn1C |
| InChI | InChI=1S/C9H19N5OS/c1-3-5-10-8(4-6-15)7-16-9-11-12-13-14(9)2/h8,10,15H,3-7H2,1-2H3 |
| InChIKey | ILFPGYDZCYMGTH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |