C7H16ClN5S — CID 44665530
N,N-dimethyl-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride (PubChem CID 44665530) has the molecular formula C7H16ClN5S and a molecular weight of 237.76 g/mol. Its IUPAC name is N,N-dimethyl-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride.
| Compound Name | N,N-dimethyl-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 44665530 |
| Molecular Formula | C7H16ClN5S |
| Molecular Weight | 237.76 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | N,N-dimethyl-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
| SMILES | CN(C)CCCSc1nnnn1C.Cl |
| InChI | InChI=1S/C7H15N5S.ClH/c1-11(2)5-4-6-13-7-8-9-10-12(7)3;/h4-6H2,1-3H3;1H |
| InChIKey | AQHWQPOHGHQTJT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.76 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|