C21H26NO4P — CID 102153558
N-[1-diethoxyphosphoryl-3-(3-methylphenyl)prop-2-ynyl]-4-methoxyaniline (PubChem CID 102153558) has the molecular formula C21H26NO4P and a molecular weight of 387.42 g/mol. Its IUPAC name is N-[1-diethoxyphosphoryl-3-(3-methylphenyl)prop-2-ynyl]-4-methoxyaniline.
| Compound Name | N-[1-diethoxyphosphoryl-3-(3-methylphenyl)prop-2-ynyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 102153558 |
| Molecular Formula | C21H26NO4P |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-[1-diethoxyphosphoryl-3-(3-methylphenyl)prop-2-ynyl]-4-methoxyaniline |
| SMILES | CCOP(=O)(OCC)C(C#Cc1cccc(C)c1)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H26NO4P/c1-5-25-27(23,26-6-2)21(15-10-18-9-7-8-17(3)16-18)22-19-11-13-20(24-4)14-12-19/h7-9,11-14,16,21-22H,5-6H2,1-4H3 |
| InChIKey | OAAIAIGGQIJUNW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|