C28H32NO7P — CID 156756289
N-[diethoxyphosphoryl-[5,6-dimethoxy-3-(4-methoxyphenyl)-1-benzofuran-2-yl]methyl]aniline (PubChem CID 156756289) has the molecular formula C28H32NO7P and a molecular weight of 525.54 g/mol. Its IUPAC name is N-[diethoxyphosphoryl-[5,6-dimethoxy-3-(4-methoxyphenyl)-1-benzofuran-2-yl]methyl]aniline.
| Compound Name | N-[diethoxyphosphoryl-[5,6-dimethoxy-3-(4-methoxyphenyl)-1-benzofuran-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 156756289 |
| Molecular Formula | C28H32NO7P |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | N-[diethoxyphosphoryl-[5,6-dimethoxy-3-(4-methoxyphenyl)-1-benzofuran-2-yl]methyl]aniline |
| SMILES | CCOP(=O)(OCC)C(Nc1ccccc1)c1oc2cc(OC)c(OC)cc2c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H32NO7P/c1-6-34-37(30,35-7-2)28(29-20-11-9-8-10-12-20)27-26(19-13-15-21(31-3)16-14-19)22-17-24(32-4)25(33-5)18-23(22)36-27/h8-18,28-29H,6-7H2,1-5H3 |
| InChIKey | GOQRGJGEBVXRMX-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|