C14H21N2O3P — CID 90222487
4-[ethoxy(methyl)phosphoryl]-2-(4-methoxyanilino)butanenitrile (PubChem CID 90222487) has the molecular formula C14H21N2O3P and a molecular weight of 296.31 g/mol. Its IUPAC name is 4-[ethoxy(methyl)phosphoryl]-2-(4-methoxyanilino)butanenitrile.
| Compound Name | 4-[ethoxy(methyl)phosphoryl]-2-(4-methoxyanilino)butanenitrile |
|---|---|
| PubChem CID | 90222487 |
| Molecular Formula | C14H21N2O3P |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-[ethoxy(methyl)phosphoryl]-2-(4-methoxyanilino)butanenitrile |
| SMILES | CCOP(C)(=O)CCC(C#N)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H21N2O3P/c1-4-19-20(3,17)10-9-13(11-15)16-12-5-7-14(18-2)8-6-12/h5-8,13,16H,4,9-10H2,1-3H3 |
| InChIKey | BJZLHWKMJDYYMQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|