C17H19ClNO5P — CID 14959162
[(4-chlorophenyl)-(phenylmethoxycarbonylamino)methyl]-ethoxyphosphinic acid (PubChem CID 14959162) has the molecular formula C17H19ClNO5P and a molecular weight of 383.77 g/mol. Its IUPAC name is [(4-chlorophenyl)-(phenylmethoxycarbonylamino)methyl]-ethoxyphosphinic acid.
| Compound Name | [(4-chlorophenyl)-(phenylmethoxycarbonylamino)methyl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 14959162 |
| Molecular Formula | C17H19ClNO5P |
| Molecular Weight | 383.77 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | [(4-chlorophenyl)-(phenylmethoxycarbonylamino)methyl]-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)C(NC(=O)OCc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClNO5P/c1-2-24-25(21,22)16(14-8-10-15(18)11-9-14)19-17(20)23-12-13-6-4-3-5-7-13/h3-11,16H,2,12H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | GJWQYLTXISJZFS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.77 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|