C26H27N3O5S — CID 132547388
tert-butyl N-[(S)-[(3S)-1-benzyl-3-nitro-2-oxo-4H-quinolin-3-yl]-thiophen-3-ylmethyl]carbamate (PubChem CID 132547388) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is tert-butyl N-[(S)-[(3S)-1-benzyl-3-nitro-2-oxo-4H-quinolin-3-yl]-thiophen-3-ylmethyl]carbamate.
| Compound Name | tert-butyl N-[(S)-[(3S)-1-benzyl-3-nitro-2-oxo-4H-quinolin-3-yl]-thiophen-3-ylmethyl]carbamate |
|---|---|
| PubChem CID | 132547388 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | tert-butyl N-[(S)-[(3S)-1-benzyl-3-nitro-2-oxo-4H-quinolin-3-yl]-thiophen-3-ylmethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccsc1)[C@@]1([N+](=O)[O-])Cc2ccccc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C26H27N3O5S/c1-25(2,3)34-24(31)27-22(20-13-14-35-17-20)26(29(32)33)15-19-11-7-8-12-21(19)28(23(26)30)16-18-9-5-4-6-10-18/h4-14,17,22H,15-16H2,1-3H3,(H,27,31)/t22-,26-/m0/s1 |
| InChIKey | IQMQMCWRJOUTSF-NVQXNPDNSA-N |
| XLogP | 5.12 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|