C11H12BrNO — CID 86273196
1-(2-bromoethyl)-2,3-dihydroindole-2-carbaldehyde (PubChem CID 86273196) has the molecular formula C11H12BrNO and a molecular weight of 254.13 g/mol. Its IUPAC name is 1-(2-bromoethyl)-2,3-dihydroindole-2-carbaldehyde.
| Compound Name | 1-(2-bromoethyl)-2,3-dihydroindole-2-carbaldehyde |
|---|---|
| PubChem CID | 86273196 |
| Molecular Formula | C11H12BrNO |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 1-(2-bromoethyl)-2,3-dihydroindole-2-carbaldehyde |
| SMILES | O=CC1Cc2ccccc2N1CCBr |
| InChI | InChI=1S/C11H12BrNO/c12-5-6-13-10(8-14)7-9-3-1-2-4-11(9)13/h1-4,8,10H,5-7H2 |
| InChIKey | XAULUCSVVQOAOW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|