C14H21N — CID 90799383
ethane;(2S)-1-methyl-2-[(E)-prop-1-enyl]-2,3-dihydroindole (PubChem CID 90799383) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;(2S)-1-methyl-2-[(E)-prop-1-enyl]-2,3-dihydroindole.
| Compound Name | ethane;(2S)-1-methyl-2-[(E)-prop-1-enyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 90799383 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | ethane;(2S)-1-methyl-2-[(E)-prop-1-enyl]-2,3-dihydroindole |
| SMILES | C/C=C/[C@@H]1Cc2ccccc2N1C.CC |
| InChI | InChI=1S/C12H15N.C2H6/c1-3-6-11-9-10-7-4-5-8-12(10)13(11)2;1-2/h3-8,11H,9H2,1-2H3;1-2H3/b6-3+;/t11-;/m1./s1 |
| InChIKey | HMLYJRJMYYCOMW-LUDCHAHFSA-N |
| XLogP | 3.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|