C11H15NO — CID 58765416
(2S)-2-(methoxymethyl)-1-methyl-2,3-dihydroindole (PubChem CID 58765416) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (2S)-2-(methoxymethyl)-1-methyl-2,3-dihydroindole.
| Compound Name | (2S)-2-(methoxymethyl)-1-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 58765416 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (2S)-2-(methoxymethyl)-1-methyl-2,3-dihydroindole |
| SMILES | COC[C@@H]1Cc2ccccc2N1C |
| InChI | InChI=1S/C11H15NO/c1-12-10(8-13-2)7-9-5-3-4-6-11(9)12/h3-6,10H,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | FHSCYRRYTANWSW-JTQLQIEISA-N |
| XLogP | 1.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |