C22H23NO3 — CID 101118128
(2R)-2-ethyl-2-hydroxy-1-[(2S)-2-(methoxymethyl)-2,3-dihydroindol-1-yl]-4-phenylbut-3-yn-1-one (PubChem CID 101118128) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (2R)-2-ethyl-2-hydroxy-1-[(2S)-2-(methoxymethyl)-2,3-dihydroindol-1-yl]-4-phenylbut-3-yn-1-one.
| Compound Name | (2R)-2-ethyl-2-hydroxy-1-[(2S)-2-(methoxymethyl)-2,3-dihydroindol-1-yl]-4-phenylbut-3-yn-1-one |
|---|---|
| PubChem CID | 101118128 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (2R)-2-ethyl-2-hydroxy-1-[(2S)-2-(methoxymethyl)-2,3-dihydroindol-1-yl]-4-phenylbut-3-yn-1-one |
| SMILES | CC[C@@](O)(C#Cc1ccccc1)C(=O)N1c2ccccc2C[C@H]1COC |
| InChI | InChI=1S/C22H23NO3/c1-3-22(25,14-13-17-9-5-4-6-10-17)21(24)23-19(16-26-2)15-18-11-7-8-12-20(18)23/h4-12,19,25H,3,15-16H2,1-2H3/t19-,22+/m0/s1 |
| InChIKey | QVHKYESJFFVXAY-SIKLNZKXSA-N |
| XLogP | 2.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|