2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid

C12H15NO3 — CID 170196802

IUPAC2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid
SMILESCN1c2ccccc2C[C@H]1COCC(=O)O
InChIInChI=1S/C12H15NO3/c1-13-10(7-16-8-12(14)15)6-9-4-2-3-5-11(9)13/h2-5,10H,6-8H2,1H3,(H,14,15)/t10-/m0/s1
InChIKeyLMZIEODHVDRCOX-JTQLQIEISA-N
MW221.26 g/mol
LogP1.15
Rot. Bonds4

About 2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid

2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid (PubChem CID 170196802) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid.

Molecular Properties

Compound Name2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid
PubChem CID170196802
Molecular FormulaC12H15NO3
Molecular Weight221.26 g/mol
Exact Mass221.11
IUPAC Name2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid
SMILESCN1c2ccccc2C[C@H]1COCC(=O)O
InChIInChI=1S/C12H15NO3/c1-13-10(7-16-8-12(14)15)6-9-4-2-3-5-11(9)13/h2-5,10H,6-8H2,1H3,(H,14,15)/t10-/m0/s1
InChIKeyLMZIEODHVDRCOX-JTQLQIEISA-N
XLogP1.15
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.26
LogP ≤ 51.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid?
The IUPAC name of 2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid (CID 170196802) is 2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid.
What is the SMILES notation for 2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid?
The canonical SMILES for 2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid is CN1c2ccccc2C[C@H]1COCC(=O)O.
What is the InChIKey of 2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid?
The InChIKey is LMZIEODHVDRCOX-JTQLQIEISA-N. The full InChI is InChI=1S/C12H15NO3/c1-13-10(7-16-8-12(14)15)6-9-4-2-3-5-11(9)13/h2-5,10H,6-8H2,1H3,(H,14,15)/t10-/m0/s1.
What are the key properties of 2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid?
2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid has a molecular weight of 221.26 g/mol, XLogP of 1.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-1-methyl-2,3-dihydroindol-2-yl]methoxy]acetic acid is sourced from PubChem (CID 170196802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).