C9H11NO — CID 70661566
1-methyl-2,3-dihydroindol-2-ol (PubChem CID 70661566) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 1-methyl-2,3-dihydroindol-2-ol.
| Compound Name | 1-methyl-2,3-dihydroindol-2-ol |
|---|---|
| PubChem CID | 70661566 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 1-methyl-2,3-dihydroindol-2-ol |
| SMILES | CN1c2ccccc2CC1O |
| InChI | InChI=1S/C9H11NO/c1-10-8-5-3-2-4-7(8)6-9(10)11/h2-5,9,11H,6H2,1H3 |
| InChIKey | MPUJBXWINAUKNJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |