C15H23NO — CID 123732001
ethane;1,3,4-trimethyl-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 123732001) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is ethane;1,3,4-trimethyl-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | ethane;1,3,4-trimethyl-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 123732001 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | ethane;1,3,4-trimethyl-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | CC.CC1Cc2ccccc2N(C)C(=O)C1C |
| InChI | InChI=1S/C13H17NO.C2H6/c1-9-8-11-6-4-5-7-12(11)14(3)13(15)10(9)2;1-2/h4-7,9-10H,8H2,1-3H3;1-2H3 |
| InChIKey | SRHDLAJDESZLGY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |