C15H20BrN — CID 65009516
1-[[1-(bromomethyl)cyclobutyl]methyl]-2-methyl-2,3-dihydroindole (PubChem CID 65009516) has the molecular formula C15H20BrN and a molecular weight of 294.24 g/mol. Its IUPAC name is 1-[[1-(bromomethyl)cyclobutyl]methyl]-2-methyl-2,3-dihydroindole.
| Compound Name | 1-[[1-(bromomethyl)cyclobutyl]methyl]-2-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 65009516 |
| Molecular Formula | C15H20BrN |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 1-[[1-(bromomethyl)cyclobutyl]methyl]-2-methyl-2,3-dihydroindole |
| SMILES | CC1Cc2ccccc2N1CC1(CBr)CCC1 |
| InChI | InChI=1S/C15H20BrN/c1-12-9-13-5-2-3-6-14(13)17(12)11-15(10-16)7-4-8-15/h2-3,5-6,12H,4,7-11H2,1H3 |
| InChIKey | UASOWFRDZUVEQA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|