C15H21NO2 — CID 66473506
1-[2-(1,3-dioxan-2-yl)ethyl]-2-methyl-2,3-dihydroindole (PubChem CID 66473506) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-[2-(1,3-dioxan-2-yl)ethyl]-2-methyl-2,3-dihydroindole.
| Compound Name | 1-[2-(1,3-dioxan-2-yl)ethyl]-2-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 66473506 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1-[2-(1,3-dioxan-2-yl)ethyl]-2-methyl-2,3-dihydroindole |
| SMILES | CC1Cc2ccccc2N1CCC1OCCCO1 |
| InChI | InChI=1S/C15H21NO2/c1-12-11-13-5-2-3-6-14(13)16(12)8-7-15-17-9-4-10-18-15/h2-3,5-6,12,15H,4,7-11H2,1H3 |
| InChIKey | VJFTVKSQKZECNR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |