C16H24N2 — CID 113447993
1-cyclopentyl-2-(2-methyl-2,3-dihydroindol-1-yl)ethanamine (PubChem CID 113447993) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-cyclopentyl-2-(2-methyl-2,3-dihydroindol-1-yl)ethanamine.
| Compound Name | 1-cyclopentyl-2-(2-methyl-2,3-dihydroindol-1-yl)ethanamine |
|---|---|
| PubChem CID | 113447993 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-cyclopentyl-2-(2-methyl-2,3-dihydroindol-1-yl)ethanamine |
| SMILES | CC1Cc2ccccc2N1CC(N)C1CCCC1 |
| InChI | InChI=1S/C16H24N2/c1-12-10-14-8-4-5-9-16(14)18(12)11-15(17)13-6-2-3-7-13/h4-5,8-9,12-13,15H,2-3,6-7,10-11,17H2,1H3 |
| InChIKey | WKCXKHCAZWMXKZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |