C15H24N2O — CID 81101497
5-methoxy-1-(2-methyl-2,3-dihydroindol-1-yl)pentan-2-amine (PubChem CID 81101497) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 5-methoxy-1-(2-methyl-2,3-dihydroindol-1-yl)pentan-2-amine.
| Compound Name | 5-methoxy-1-(2-methyl-2,3-dihydroindol-1-yl)pentan-2-amine |
|---|---|
| PubChem CID | 81101497 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 5-methoxy-1-(2-methyl-2,3-dihydroindol-1-yl)pentan-2-amine |
| SMILES | COCCCC(N)CN1c2ccccc2CC1C |
| InChI | InChI=1S/C15H24N2O/c1-12-10-13-6-3-4-8-15(13)17(12)11-14(16)7-5-9-18-2/h3-4,6,8,12,14H,5,7,9-11,16H2,1-2H3 |
| InChIKey | YCQYYBGIBAKRAU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|