C15H24N2 — CID 65228439
2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]pentan-1-amine (PubChem CID 65228439) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]pentan-1-amine.
| Compound Name | 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 65228439 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]pentan-1-amine |
| SMILES | CCCC(CN)CN1c2ccccc2CC1C |
| InChI | InChI=1S/C15H24N2/c1-3-6-13(10-16)11-17-12(2)9-14-7-4-5-8-15(14)17/h4-5,7-8,12-13H,3,6,9-11,16H2,1-2H3 |
| InChIKey | YCKZYSMSTGRXJD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |