C15H24N2 — CID 114993614
2-(2-methyl-2,3-dihydroindol-1-yl)hexan-1-amine (PubChem CID 114993614) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-(2-methyl-2,3-dihydroindol-1-yl)hexan-1-amine.
| Compound Name | 2-(2-methyl-2,3-dihydroindol-1-yl)hexan-1-amine |
|---|---|
| PubChem CID | 114993614 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2-(2-methyl-2,3-dihydroindol-1-yl)hexan-1-amine |
| SMILES | CCCCC(CN)N1c2ccccc2CC1C |
| InChI | InChI=1S/C15H24N2/c1-3-4-8-14(11-16)17-12(2)10-13-7-5-6-9-15(13)17/h5-7,9,12,14H,3-4,8,10-11,16H2,1-2H3 |
| InChIKey | IEBHHSIJLJEPRX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |