C17H28N2 — CID 43130428
2-(2-methyl-2,3-dihydroindol-1-yl)octan-1-amine (PubChem CID 43130428) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 2-(2-methyl-2,3-dihydroindol-1-yl)octan-1-amine.
| Compound Name | 2-(2-methyl-2,3-dihydroindol-1-yl)octan-1-amine |
|---|---|
| PubChem CID | 43130428 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 2-(2-methyl-2,3-dihydroindol-1-yl)octan-1-amine |
| SMILES | CCCCCCC(CN)N1c2ccccc2CC1C |
| InChI | InChI=1S/C17H28N2/c1-3-4-5-6-10-16(13-18)19-14(2)12-15-9-7-8-11-17(15)19/h7-9,11,14,16H,3-6,10,12-13,18H2,1-2H3 |
| InChIKey | ZFMXABCQTHAFLC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|