C14H30N2 — CID 79188205
2-(3,4-dimethylpyrrolidin-1-yl)octan-1-amine (PubChem CID 79188205) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 2-(3,4-dimethylpyrrolidin-1-yl)octan-1-amine.
| Compound Name | 2-(3,4-dimethylpyrrolidin-1-yl)octan-1-amine |
|---|---|
| PubChem CID | 79188205 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 2-(3,4-dimethylpyrrolidin-1-yl)octan-1-amine |
| SMILES | CCCCCCC(CN)N1CC(C)C(C)C1 |
| InChI | InChI=1S/C14H30N2/c1-4-5-6-7-8-14(9-15)16-10-12(2)13(3)11-16/h12-14H,4-11,15H2,1-3H3 |
| InChIKey | DICWDMHGIWTVKH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|