C19H37F2N — CID 166714700
(3R,4R)-3,4-difluoro-1-pentadecan-8-ylpyrrolidine (PubChem CID 166714700) has the molecular formula C19H37F2N and a molecular weight of 317.51 g/mol. Its IUPAC name is (3R,4R)-3,4-difluoro-1-pentadecan-8-ylpyrrolidine.
| Compound Name | (3R,4R)-3,4-difluoro-1-pentadecan-8-ylpyrrolidine |
|---|---|
| PubChem CID | 166714700 |
| Molecular Formula | C19H37F2N |
| Molecular Weight | 317.51 g/mol |
| Exact Mass | 317.29 |
| IUPAC Name | (3R,4R)-3,4-difluoro-1-pentadecan-8-ylpyrrolidine |
| SMILES | CCCCCCCC(CCCCCCC)N1C[C@@H](F)[C@H](F)C1 |
| InChI | InChI=1S/C19H37F2N/c1-3-5-7-9-11-13-17(14-12-10-8-6-4-2)22-15-18(20)19(21)16-22/h17-19H,3-16H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | ODSSFNYMQPMHQE-RTBURBONSA-N |
| XLogP | 6.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|