About 1-decan-4-ylpiperidine
1-decan-4-ylpiperidine (PubChem CID 142178259) has the molecular formula C15H31N
and a molecular weight of 225.42 g/mol. Its IUPAC name is 1-decan-4-ylpiperidine.
Molecular Properties
| Compound Name | 1-decan-4-ylpiperidine |
| PubChem CID | 142178259 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | 1-decan-4-ylpiperidine |
| SMILES | CCCCCCC(CCC)N1CCCCC1 |
| InChI | InChI=1S/C15H31N/c1-3-5-6-8-12-15(11-4-2)16-13-9-7-10-14-16/h15H,3-14H2,1-2H3 |
| InChIKey | UMWPRAOPWHKAIV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-decan-4-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decan-4-ylpiperidine?
The IUPAC name of 1-decan-4-ylpiperidine (CID 142178259) is 1-decan-4-ylpiperidine.
What is the SMILES notation for 1-decan-4-ylpiperidine?
The canonical SMILES for 1-decan-4-ylpiperidine is CCCCCCC(CCC)N1CCCCC1.
What is the InChIKey of 1-decan-4-ylpiperidine?
The InChIKey is UMWPRAOPWHKAIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N/c1-3-5-6-8-12-15(11-4-2)16-13-9-7-10-14-16/h15H,3-14H2,1-2H3.
What are the key properties of 1-decan-4-ylpiperidine?
1-decan-4-ylpiperidine has a molecular weight of 225.42 g/mol, XLogP of 4.61, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decan-4-ylpiperidine is sourced from PubChem (CID 142178259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).