About methane;1-octan-4-ylpiperidine
methane;1-octan-4-ylpiperidine (PubChem CID 143122058) has the molecular formula C14H31N
and a molecular weight of 213.41 g/mol. Its IUPAC name is methane;1-octan-4-ylpiperidine.
Molecular Properties
| Compound Name | methane;1-octan-4-ylpiperidine |
| PubChem CID | 143122058 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | methane;1-octan-4-ylpiperidine |
| SMILES | C.CCCCC(CCC)N1CCCCC1 |
| InChI | InChI=1S/C13H27N.CH4/c1-3-5-10-13(9-4-2)14-11-7-6-8-12-14;/h13H,3-12H2,1-2H3;1H4 |
| InChIKey | JNXOSFVTBBKAMW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;1-octan-4-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-octan-4-ylpiperidine?
The IUPAC name of methane;1-octan-4-ylpiperidine (CID 143122058) is methane;1-octan-4-ylpiperidine.
What is the SMILES notation for methane;1-octan-4-ylpiperidine?
The canonical SMILES for methane;1-octan-4-ylpiperidine is C.CCCCC(CCC)N1CCCCC1.
What is the InChIKey of methane;1-octan-4-ylpiperidine?
The InChIKey is JNXOSFVTBBKAMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N.CH4/c1-3-5-10-13(9-4-2)14-11-7-6-8-12-14;/h13H,3-12H2,1-2H3;1H4.
What are the key properties of methane;1-octan-4-ylpiperidine?
methane;1-octan-4-ylpiperidine has a molecular weight of 213.41 g/mol, XLogP of 4.47, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-octan-4-ylpiperidine is sourced from PubChem (CID 143122058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).