About 1-octan-4-ylazonane
1-octan-4-ylazonane (PubChem CID 123427772) has the molecular formula C16H33N
and a molecular weight of 239.45 g/mol. Its IUPAC name is 1-octan-4-ylazonane.
Molecular Properties
| Compound Name | 1-octan-4-ylazonane |
| PubChem CID | 123427772 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 1-octan-4-ylazonane |
| SMILES | CCCCC(CCC)N1CCCCCCCC1 |
| InChI | InChI=1S/C16H33N/c1-3-5-13-16(12-4-2)17-14-10-8-6-7-9-11-15-17/h16H,3-15H2,1-2H3 |
| InChIKey | XOJDMFFEUOTBLH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-octan-4-ylazonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octan-4-ylazonane?
The IUPAC name of 1-octan-4-ylazonane (CID 123427772) is 1-octan-4-ylazonane.
What is the SMILES notation for 1-octan-4-ylazonane?
The canonical SMILES for 1-octan-4-ylazonane is CCCCC(CCC)N1CCCCCCCC1.
What is the InChIKey of 1-octan-4-ylazonane?
The InChIKey is XOJDMFFEUOTBLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N/c1-3-5-13-16(12-4-2)17-14-10-8-6-7-9-11-15-17/h16H,3-15H2,1-2H3.
What are the key properties of 1-octan-4-ylazonane?
1-octan-4-ylazonane has a molecular weight of 239.45 g/mol, XLogP of 5.00, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octan-4-ylazonane is sourced from PubChem (CID 123427772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).