C21H43NO2 — CID 126672077
(3S,4R)-3,4-dimethoxy-1-pentadecan-8-ylpyrrolidine (PubChem CID 126672077) has the molecular formula C21H43NO2 and a molecular weight of 341.58 g/mol. Its IUPAC name is (3S,4R)-3,4-dimethoxy-1-pentadecan-8-ylpyrrolidine.
| Compound Name | (3S,4R)-3,4-dimethoxy-1-pentadecan-8-ylpyrrolidine |
|---|---|
| PubChem CID | 126672077 |
| Molecular Formula | C21H43NO2 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.33 |
| IUPAC Name | (3S,4R)-3,4-dimethoxy-1-pentadecan-8-ylpyrrolidine |
| SMILES | CCCCCCCC(CCCCCCC)N1C[C@H](OC)[C@H](OC)C1 |
| InChI | InChI=1S/C21H43NO2/c1-5-7-9-11-13-15-19(16-14-12-10-8-6-2)22-17-20(23-3)21(18-22)24-4/h19-21H,5-18H2,1-4H3/t20-,21+ |
| InChIKey | DGMTUZGKYXYYIE-OYRHEFFESA-N |
| XLogP | 5.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|